About 2,7-dimethylfuro[3,2-e][1,3]benzothiazole
2,7-dimethylfuro[3,2-e][1,3]benzothiazole (PubChem CID 59782217) has the molecular formula C11H9NOS
and a molecular weight of 203.27 g/mol. Its IUPAC name is 2,7-dimethylfuro[3,2-e][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2,7-dimethylfuro[3,2-e][1,3]benzothiazole |
| PubChem CID | 59782217 |
| Molecular Formula | C11H9NOS |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 2,7-dimethylfuro[3,2-e][1,3]benzothiazole |
| SMILES | Cc1cc2c(ccc3sc(C)nc32)o1 |
| InChI | InChI=1S/C11H9NOS/c1-6-5-8-9(13-6)3-4-10-11(8)12-7(2)14-10/h3-5H,1-2H3 |
| InChIKey | WIJCHRIIXHRTQU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7-dimethylfuro[3,2-e][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethylfuro[3,2-e][1,3]benzothiazole?
The IUPAC name of 2,7-dimethylfuro[3,2-e][1,3]benzothiazole (CID 59782217) is 2,7-dimethylfuro[3,2-e][1,3]benzothiazole.
What is the SMILES notation for 2,7-dimethylfuro[3,2-e][1,3]benzothiazole?
The canonical SMILES for 2,7-dimethylfuro[3,2-e][1,3]benzothiazole is Cc1cc2c(ccc3sc(C)nc32)o1.
What is the InChIKey of 2,7-dimethylfuro[3,2-e][1,3]benzothiazole?
The InChIKey is WIJCHRIIXHRTQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NOS/c1-6-5-8-9(13-6)3-4-10-11(8)12-7(2)14-10/h3-5H,1-2H3.
What are the key properties of 2,7-dimethylfuro[3,2-e][1,3]benzothiazole?
2,7-dimethylfuro[3,2-e][1,3]benzothiazole has a molecular weight of 203.27 g/mol, XLogP of 3.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethylfuro[3,2-e][1,3]benzothiazole is sourced from PubChem (CID 59782217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).