About (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine
(Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine (PubChem CID 59782224) has the molecular formula C7H10F3NO
and a molecular weight of 181.16 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine |
| PubChem CID | 59782224 |
| Molecular Formula | C7H10F3NO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine |
| SMILES | C/N=C(\C=C(\C)OC)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO/c1-5(12-3)4-6(11-2)7(8,9)10/h4H,1-3H3/b5-4-,11-6+ |
| InChIKey | DAPQTNJBHDPHLB-UMEJXRAUSA-N |
| XLogP | 2.17 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine?
The IUPAC name of (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine (CID 59782224) is (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine.
What is the SMILES notation for (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine?
The canonical SMILES for (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine is C/N=C(\C=C(\C)OC)C(F)(F)F.
What is the InChIKey of (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine?
The InChIKey is DAPQTNJBHDPHLB-UMEJXRAUSA-N. The full InChI is InChI=1S/C7H10F3NO/c1-5(12-3)4-6(11-2)7(8,9)10/h4H,1-3H3/b5-4-,11-6+.
What are the key properties of (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine?
(Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine has a molecular weight of 181.16 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,1,1-trifluoro-4-methoxy-N-methylpent-3-en-2-imine is sourced from PubChem (CID 59782224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).