About 4-(azidomethyl)-1,3,5-trimethylimidazolidine
4-(azidomethyl)-1,3,5-trimethylimidazolidine (PubChem CID 59782486) has the molecular formula C7H15N5
and a molecular weight of 169.23 g/mol. Its IUPAC name is 4-(azidomethyl)-1,3,5-trimethylimidazolidine.
Molecular Properties
| Compound Name | 4-(azidomethyl)-1,3,5-trimethylimidazolidine |
| PubChem CID | 59782486 |
| Molecular Formula | C7H15N5 |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 4-(azidomethyl)-1,3,5-trimethylimidazolidine |
| SMILES | CC1C(CN=[N+]=[N-])N(C)CN1C |
| InChI | InChI=1S/C7H15N5/c1-6-7(4-9-10-8)12(3)5-11(6)2/h6-7H,4-5H2,1-3H3 |
| InChIKey | IAGOOERBYYNHSK-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 55.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-(azidomethyl)-1,3,5-trimethylimidazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(azidomethyl)-1,3,5-trimethylimidazolidine?
The IUPAC name of 4-(azidomethyl)-1,3,5-trimethylimidazolidine (CID 59782486) is 4-(azidomethyl)-1,3,5-trimethylimidazolidine.
What is the SMILES notation for 4-(azidomethyl)-1,3,5-trimethylimidazolidine?
The canonical SMILES for 4-(azidomethyl)-1,3,5-trimethylimidazolidine is CC1C(CN=[N+]=[N-])N(C)CN1C.
What is the InChIKey of 4-(azidomethyl)-1,3,5-trimethylimidazolidine?
The InChIKey is IAGOOERBYYNHSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N5/c1-6-7(4-9-10-8)12(3)5-11(6)2/h6-7H,4-5H2,1-3H3.
What are the key properties of 4-(azidomethyl)-1,3,5-trimethylimidazolidine?
4-(azidomethyl)-1,3,5-trimethylimidazolidine has a molecular weight of 169.23 g/mol, XLogP of 0.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(azidomethyl)-1,3,5-trimethylimidazolidine is sourced from PubChem (CID 59782486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).