C14H14F13NO — CID 59782720
N-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnonyl)prop-2-enamide (PubChem CID 59782720) has the molecular formula C14H14F13NO and a molecular weight of 459.25 g/mol. Its IUPAC name is N-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnonyl)prop-2-enamide.
| Compound Name | N-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnonyl)prop-2-enamide |
|---|---|
| PubChem CID | 59782720 |
| Molecular Formula | C14H14F13NO |
| Molecular Weight | 459.25 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | N-methyl-N-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-3-methylnonyl)prop-2-enamide |
| SMILES | C=CC(=O)N(C)CCC(C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F13NO/c1-4-8(29)28(3)6-5-7(2)9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h4,7H,1,5-6H2,2-3H3 |
| InChIKey | ZRJFEGWTEMVNBX-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.25 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|