C19H24F13NO — CID 59782723
N-methyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-pentyldecyl)prop-2-enamide (PubChem CID 59782723) has the molecular formula C19H24F13NO and a molecular weight of 529.38 g/mol. Its IUPAC name is N-methyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-pentyldecyl)prop-2-enamide.
| Compound Name | N-methyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-pentyldecyl)prop-2-enamide |
|---|---|
| PubChem CID | 59782723 |
| Molecular Formula | C19H24F13NO |
| Molecular Weight | 529.38 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | N-methyl-N-(5,5,6,6,7,7,8,8,9,9,10,10,10-tridecafluoro-4-pentyldecyl)prop-2-enamide |
| SMILES | C=CC(=O)N(C)CCCC(CCCCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H24F13NO/c1-4-6-7-9-12(10-8-11-33(3)13(34)5-2)14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h5,12H,2,4,6-11H2,1,3H3 |
| InChIKey | MRYYJOZFSGZWKO-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.38 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|