About 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide
2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide (PubChem CID 59783317) has the molecular formula C9H18N2OS
and a molecular weight of 202.32 g/mol. Its IUPAC name is 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide.
Molecular Properties
| Compound Name | 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide |
| PubChem CID | 59783317 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide |
| SMILES | CC1NCC(CNC(=O)C(C)C)S1 |
| InChI | InChI=1S/C9H18N2OS/c1-6(2)9(12)11-5-8-4-10-7(3)13-8/h6-8,10H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | AEDYEGLOBRPBAF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide?
The IUPAC name of 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide (CID 59783317) is 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide.
What is the SMILES notation for 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide?
The canonical SMILES for 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide is CC1NCC(CNC(=O)C(C)C)S1.
What is the InChIKey of 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide?
The InChIKey is AEDYEGLOBRPBAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2OS/c1-6(2)9(12)11-5-8-4-10-7(3)13-8/h6-8,10H,4-5H2,1-3H3,(H,11,12).
What are the key properties of 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide?
2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide has a molecular weight of 202.32 g/mol, XLogP of 0.81, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[(2-methyl-1,3-thiazolidin-5-yl)methyl]propanamide is sourced from PubChem (CID 59783317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).