About (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+)
(1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) (PubChem CID 59783453) has the molecular formula C13H26N2U
and a molecular weight of 448.39 g/mol. Its IUPAC name is (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+).
Molecular Properties
| Compound Name | (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) |
| PubChem CID | 59783453 |
| Molecular Formula | C13H26N2U |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) |
| SMILES | CC(C)(C)N1C[C@@H]2C[C@H]1C[N-]2.C[C-](C)C.[U+2] |
| InChI | InChI=1S/C9H17N2.C4H9.U/c1-9(2,3)11-6-7-4-8(11)5-10-7;1-4(2)3;/h7-8H,4-6H2,1-3H3;1-3H3;/q2*-1;+2/t7-,8-;;/m0../s1 |
| InChIKey | BNRGHHKLLSIMDX-FOMWZSOGSA-N |
| XLogP | 3.24 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+)?
The IUPAC name of (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) (CID 59783453) is (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+).
What is the SMILES notation for (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+)?
The canonical SMILES for (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) is CC(C)(C)N1C[C@@H]2C[C@H]1C[N-]2.C[C-](C)C.[U+2].
What is the InChIKey of (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+)?
The InChIKey is BNRGHHKLLSIMDX-FOMWZSOGSA-N. The full InChI is InChI=1S/C9H17N2.C4H9.U/c1-9(2,3)11-6-7-4-8(11)5-10-7;1-4(2)3;/h7-8H,4-6H2,1-3H3;1-3H3;/q2*-1;+2/t7-,8-;;/m0../s1.
What are the key properties of (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+)?
(1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) has a molecular weight of 448.39 g/mol, XLogP of 3.24, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4S)-2-tert-butyl-2-aza-5-azanidabicyclo[2.2.1]heptane;2-methylpropane;uranium(2+) is sourced from PubChem (CID 59783453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).