About 1-fluoropropane;2-methylpropane;yttrium
1-fluoropropane;2-methylpropane;yttrium (PubChem CID 59783576) has the molecular formula C7H15FY-2
and a molecular weight of 207.10 g/mol. Its IUPAC name is 1-fluoropropane;2-methylpropane;yttrium.
Molecular Properties
| Compound Name | 1-fluoropropane;2-methylpropane;yttrium |
|---|
| PubChem CID | 59783576 |
|---|
| Molecular Formula | C7H15FY-2 |
|---|
| Molecular Weight | 207.10 g/mol |
|---|
| Exact Mass | 207.02 |
|---|
| IUPAC Name | 1-fluoropropane;2-methylpropane;yttrium |
|---|
| SMILES | C[C-](C)C.[CH2-]CCF.[Y] |
|---|
| InChI | InChI=1S/C4H9.C3H6F.Y/c1-4(2)3;1-2-3-4;/h1-3H3;1-3H2;/q2*-1; |
|---|
| InChIKey | YHAUIUDBUZXIKW-UHFFFAOYSA-N |
|---|
| XLogP | 2.80 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | 1 |
|---|
| Heavy Atoms | 9 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 207.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoropropane;2-methylpropane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoropropane;2-methylpropane;yttrium?
The IUPAC name of 1-fluoropropane;2-methylpropane;yttrium (CID 59783576) is 1-fluoropropane;2-methylpropane;yttrium.
What is the SMILES notation for 1-fluoropropane;2-methylpropane;yttrium?
The canonical SMILES for 1-fluoropropane;2-methylpropane;yttrium is C[C-](C)C.[CH2-]CCF.[Y].
What is the InChIKey of 1-fluoropropane;2-methylpropane;yttrium?
The InChIKey is YHAUIUDBUZXIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.C3H6F.Y/c1-4(2)3;1-2-3-4;/h1-3H3;1-3H2;/q2*-1;.
What are the key properties of 1-fluoropropane;2-methylpropane;yttrium?
1-fluoropropane;2-methylpropane;yttrium has a molecular weight of 207.10 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoropropane;2-methylpropane;yttrium is sourced from PubChem (CID 59783576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).