C23H32N2O4 — CID 597836
4-N,5-N-dicyclohexyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide (PubChem CID 597836) has the molecular formula C23H32N2O4 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-N,5-N-dicyclohexyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide.
| Compound Name | 4-N,5-N-dicyclohexyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
|---|---|
| PubChem CID | 597836 |
| Molecular Formula | C23H32N2O4 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 4-N,5-N-dicyclohexyl-2-phenyl-1,3-dioxolane-4,5-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1OC(c2ccccc2)OC1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C23H32N2O4/c26-21(24-17-12-6-2-7-13-17)19-20(22(27)25-18-14-8-3-9-15-18)29-23(28-19)16-10-4-1-5-11-16/h1,4-5,10-11,17-20,23H,2-3,6-9,12-15H2,(H,24,26)(H,25,27) |
| InChIKey | CHTQJBSPBRYKPI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |