About 2,3-ditert-butyl-1,1-difluorocyclopropane
2,3-ditert-butyl-1,1-difluorocyclopropane (PubChem CID 59783656) has the molecular formula C11H20F2
and a molecular weight of 190.28 g/mol. Its IUPAC name is 2,3-ditert-butyl-1,1-difluorocyclopropane.
Molecular Properties
| Compound Name | 2,3-ditert-butyl-1,1-difluorocyclopropane |
| PubChem CID | 59783656 |
| Molecular Formula | C11H20F2 |
| Molecular Weight | 190.28 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2,3-ditert-butyl-1,1-difluorocyclopropane |
| SMILES | CC(C)(C)C1C(C(C)(C)C)C1(F)F |
| InChI | InChI=1S/C11H20F2/c1-9(2,3)7-8(10(4,5)6)11(7,12)13/h7-8H,1-6H3 |
| InChIKey | RQLMBFIADUOQCT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.28 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-ditert-butyl-1,1-difluorocyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-ditert-butyl-1,1-difluorocyclopropane?
The IUPAC name of 2,3-ditert-butyl-1,1-difluorocyclopropane (CID 59783656) is 2,3-ditert-butyl-1,1-difluorocyclopropane.
What is the SMILES notation for 2,3-ditert-butyl-1,1-difluorocyclopropane?
The canonical SMILES for 2,3-ditert-butyl-1,1-difluorocyclopropane is CC(C)(C)C1C(C(C)(C)C)C1(F)F.
What is the InChIKey of 2,3-ditert-butyl-1,1-difluorocyclopropane?
The InChIKey is RQLMBFIADUOQCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2/c1-9(2,3)7-8(10(4,5)6)11(7,12)13/h7-8H,1-6H3.
What are the key properties of 2,3-ditert-butyl-1,1-difluorocyclopropane?
2,3-ditert-butyl-1,1-difluorocyclopropane has a molecular weight of 190.28 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-ditert-butyl-1,1-difluorocyclopropane is sourced from PubChem (CID 59783656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).