C26H26N9O2S3Y- — CID 59784131
N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-(6-methyl-7,9-dihydropyrimido[4,5-b]indol-7-id-4-yl)piperazine-1-carbothioamide;yttrium (PubChem CID 59784131) has the molecular formula C26H26N9O2S3Y- and a molecular weight of 681.66 g/mol. Its IUPAC name is N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-(6-methyl-7,9-dihydropyrimido[4,5-b]indol-7-id-4-yl)piperazine-1-carbothioamide;yttrium.
| Compound Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-(6-methyl-7,9-dihydropyrimido[4,5-b]indol-7-id-4-yl)piperazine-1-carbothioamide;yttrium |
|---|---|
| PubChem CID | 59784131 |
| Molecular Formula | C26H26N9O2S3Y- |
| Molecular Weight | 681.66 g/mol |
| Exact Mass | 681.04 |
| IUPAC Name | N-[4-[(5-ethyl-1,3,4-thiadiazol-2-yl)sulfamoyl]phenyl]-4-(6-methyl-7,9-dihydropyrimido[4,5-b]indol-7-id-4-yl)piperazine-1-carbothioamide;yttrium |
| SMILES | CCc1nnc(NS(=O)(=O)c2ccc(NC(=S)N3CCN(c4ncnc5[nH]c6c[c-]c(C)cc6c45)CC3)cc2)s1.[Y] |
| InChI | InChI=1S/C26H26N9O2S3.Y/c1-3-21-31-32-25(39-21)33-40(36,37)18-7-5-17(6-8-18)29-26(38)35-12-10-34(11-13-35)24-22-19-14-16(2)4-9-20(19)30-23(22)27-15-28-24;/h5-9,14-15H,3,10-13H2,1-2H3,(H,29,38)(H,32,33)(H,27,28,30);/q-1; |
| InChIKey | WIKCEUYIIDKVNX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.66 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|