About 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid
2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid (PubChem CID 59784715) has the molecular formula C18H13N5O2
and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid |
| PubChem CID | 59784715 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(-c2nc3cc4c[nH][nH]c4cc3n2)c2ccccc21 |
| InChI | InChI=1S/C18H13N5O2/c24-17(25)9-23-8-12(11-3-1-2-4-16(11)23)18-20-14-5-10-7-19-22-13(10)6-15(14)21-18/h1-8,19,22H,9H2,(H,24,25) |
| InChIKey | CFIFBLKAPZCIKX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid?
The IUPAC name of 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid (CID 59784715) is 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid?
The canonical SMILES for 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid is O=C(O)Cn1cc(-c2nc3cc4c[nH][nH]c4cc3n2)c2ccccc21.
What is the InChIKey of 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid?
The InChIKey is CFIFBLKAPZCIKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O2/c24-17(25)9-23-8-12(11-3-1-2-4-16(11)23)18-20-14-5-10-7-19-22-13(10)6-15(14)21-18/h1-8,19,22H,9H2,(H,24,25).
What are the key properties of 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid?
2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid has a molecular weight of 331.34 g/mol, XLogP of 3.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(1,2-dihydroimidazo[4,5-f]indazol-6-yl)indol-1-yl]acetic acid is sourced from PubChem (CID 59784715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).