About 2-chloro-4,6-dimethylpyridine-3-carboxamide
2-chloro-4,6-dimethylpyridine-3-carboxamide (PubChem CID 597857) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is 2-chloro-4,6-dimethylpyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-chloro-4,6-dimethylpyridine-3-carboxamide |
| PubChem CID | 597857 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 2-chloro-4,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(C)c(C(N)=O)c(Cl)n1 |
| InChI | InChI=1S/C8H9ClN2O/c1-4-3-5(2)11-7(9)6(4)8(10)12/h3H,1-2H3,(H2,10,12) |
| InChIKey | NNBAGQPBTCYTKF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4,6-dimethylpyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-dimethylpyridine-3-carboxamide?
The IUPAC name of 2-chloro-4,6-dimethylpyridine-3-carboxamide (CID 597857) is 2-chloro-4,6-dimethylpyridine-3-carboxamide.
What is the SMILES notation for 2-chloro-4,6-dimethylpyridine-3-carboxamide?
The canonical SMILES for 2-chloro-4,6-dimethylpyridine-3-carboxamide is Cc1cc(C)c(C(N)=O)c(Cl)n1.
What is the InChIKey of 2-chloro-4,6-dimethylpyridine-3-carboxamide?
The InChIKey is NNBAGQPBTCYTKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O/c1-4-3-5(2)11-7(9)6(4)8(10)12/h3H,1-2H3,(H2,10,12).
What are the key properties of 2-chloro-4,6-dimethylpyridine-3-carboxamide?
2-chloro-4,6-dimethylpyridine-3-carboxamide has a molecular weight of 184.63 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-dimethylpyridine-3-carboxamide is sourced from PubChem (CID 597857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).