About lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate
lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate (PubChem CID 59785913) has the molecular formula C6H9LiO4
and a molecular weight of 152.07 g/mol. Its IUPAC name is lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
Molecular Properties
| Compound Name | lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| PubChem CID | 59785913 |
| Molecular Formula | C6H9LiO4 |
| Molecular Weight | 152.07 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate |
| SMILES | CC1(C)OC[C@@H](C(=O)[O-])O1.[Li+] |
| InChI | InChI=1S/C6H10O4.Li/c1-6(2)9-3-4(10-6)5(7)8;/h4H,3H2,1-2H3,(H,7,8);/q;+1/p-1/t4-;/m0./s1 |
| InChIKey | GCGLKGWYCNOQIT-WCCKRBBISA-M |
| XLogP | -4.11 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.07 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The IUPAC name of lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate (CID 59785913) is lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The canonical SMILES for lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate is CC1(C)OC[C@@H](C(=O)[O-])O1.[Li+].
What is the InChIKey of lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
The InChIKey is GCGLKGWYCNOQIT-WCCKRBBISA-M. The full InChI is InChI=1S/C6H10O4.Li/c1-6(2)9-3-4(10-6)5(7)8;/h4H,3H2,1-2H3,(H,7,8);/q;+1/p-1/t4-;/m0./s1.
What are the key properties of lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate?
lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate has a molecular weight of 152.07 g/mol, XLogP of -4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for lithium (4S)-2,2-dimethyl-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 59785913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).