C6H14N2O4S2 — CID 59786640
N,N-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide (PubChem CID 59786640) has the molecular formula C6H14N2O4S2 and a molecular weight of 242.32 g/mol. Its IUPAC name is N,N-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide.
| Compound Name | N,N-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
|---|---|
| PubChem CID | 59786640 |
| Molecular Formula | C6H14N2O4S2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | N,N-dimethyl-1,1-dioxo-1,4-thiazinane-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C6H14N2O4S2/c1-7(2)14(11,12)8-3-5-13(9,10)6-4-8/h3-6H2,1-2H3 |
| InChIKey | FVWIGDIGGAERPL-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |