About 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline
9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline (PubChem CID 597871) has the molecular formula C12H10ClN
and a molecular weight of 203.67 g/mol. Its IUPAC name is 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline.
Molecular Properties
| Compound Name | 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline |
| PubChem CID | 597871 |
| Molecular Formula | C12H10ClN |
| Molecular Weight | 203.67 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline |
| SMILES | Clc1c2c(nc3ccccc13)CCC2 |
| InChI | InChI=1S/C12H10ClN/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12/h1-2,4,6H,3,5,7H2 |
| InChIKey | GSUKEUPKOXDHCG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.67 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline?
The IUPAC name of 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline (CID 597871) is 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline.
What is the SMILES notation for 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline?
The canonical SMILES for 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline is Clc1c2c(nc3ccccc13)CCC2.
What is the InChIKey of 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline?
The InChIKey is GSUKEUPKOXDHCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12/h1-2,4,6H,3,5,7H2.
What are the key properties of 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline?
9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline has a molecular weight of 203.67 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-chloro-2,3-dihydro-1H-cyclopenta[b]quinoline is sourced from PubChem (CID 597871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).