About 4-azaniumylbutyl carbonate
4-azaniumylbutyl carbonate (PubChem CID 59787340) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4-azaniumylbutyl carbonate.
Molecular Properties
| Compound Name | 4-azaniumylbutyl carbonate |
| PubChem CID | 59787340 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | 4-azaniumylbutyl carbonate |
| SMILES | [NH3+]CCCCOC(=O)[O-] |
| InChI | InChI=1S/C5H11NO3/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H,7,8) |
| InChIKey | NAOCFUVCOWSBHZ-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-azaniumylbutyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaniumylbutyl carbonate?
The IUPAC name of 4-azaniumylbutyl carbonate (CID 59787340) is 4-azaniumylbutyl carbonate.
What is the SMILES notation for 4-azaniumylbutyl carbonate?
The canonical SMILES for 4-azaniumylbutyl carbonate is [NH3+]CCCCOC(=O)[O-].
What is the InChIKey of 4-azaniumylbutyl carbonate?
The InChIKey is NAOCFUVCOWSBHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO3/c6-3-1-2-4-9-5(7)8/h1-4,6H2,(H,7,8).
What are the key properties of 4-azaniumylbutyl carbonate?
4-azaniumylbutyl carbonate has a molecular weight of 133.15 g/mol, XLogP of -1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaniumylbutyl carbonate is sourced from PubChem (CID 59787340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).