C19H14ClF3N2O — CID 59787357
1-[7-chloro-6-(2-pyridin-3-ylethynyl)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone (PubChem CID 59787357) has the molecular formula C19H14ClF3N2O and a molecular weight of 378.78 g/mol. Its IUPAC name is 1-[7-chloro-6-(2-pyridin-3-ylethynyl)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[7-chloro-6-(2-pyridin-3-ylethynyl)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 59787357 |
| Molecular Formula | C19H14ClF3N2O |
| Molecular Weight | 378.78 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | 1-[7-chloro-6-(2-pyridin-3-ylethynyl)-1,2,4,5-tetrahydro-3-benzazepin-3-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCc2ccc(Cl)c(C#Cc3cccnc3)c2CC1)C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N2O/c20-17-6-4-14-7-10-25(18(26)19(21,22)23)11-8-15(14)16(17)5-3-13-2-1-9-24-12-13/h1-2,4,6,9,12H,7-8,10-11H2 |
| InChIKey | ULGOQBIFXBINTA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|