C19H20BrNO4 — CID 59787504
11-bromo-7,9-dimethoxy-3-methyl-2,4,6,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-ol (PubChem CID 59787504) has the molecular formula C19H20BrNO4 and a molecular weight of 406.28 g/mol. Its IUPAC name is 11-bromo-7,9-dimethoxy-3-methyl-2,4,6,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-ol.
| Compound Name | 11-bromo-7,9-dimethoxy-3-methyl-2,4,6,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-ol |
|---|---|
| PubChem CID | 59787504 |
| Molecular Formula | C19H20BrNO4 |
| Molecular Weight | 406.28 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | 11-bromo-7,9-dimethoxy-3-methyl-2,4,6,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-6-ol |
| SMILES | COC1=C2Oc3c(OC)cc(Br)c4c3C23CCN(C)C(C4)C3=CC1O |
| InChI | InChI=1S/C19H20BrNO4/c1-21-5-4-19-10-7-13(22)16(24-3)18(19)25-17-14(23-2)8-11(20)9(15(17)19)6-12(10)21/h7-8,12-13,22H,4-6H2,1-3H3 |
| InChIKey | IZICVNANNOXJBS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|