C11H14N6O4S — CID 59787556
4-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]oxy]benzenesulfonic acid (PubChem CID 59787556) has the molecular formula C11H14N6O4S and a molecular weight of 326.34 g/mol. Its IUPAC name is 4-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]oxy]benzenesulfonic acid.
| Compound Name | 4-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]oxy]benzenesulfonic acid |
|---|---|
| PubChem CID | 59787556 |
| Molecular Formula | C11H14N6O4S |
| Molecular Weight | 326.34 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 4-[[4-amino-6-(2-aminoethylamino)-1,3,5-triazin-2-yl]oxy]benzenesulfonic acid |
| SMILES | NCCNc1nc(N)nc(Oc2ccc(S(=O)(=O)O)cc2)n1 |
| InChI | InChI=1S/C11H14N6O4S/c12-5-6-14-10-15-9(13)16-11(17-10)21-7-1-3-8(4-2-7)22(18,19)20/h1-4H,5-6,12H2,(H,18,19,20)(H3,13,14,15,16,17) |
| InChIKey | BKSFAQRNQYVYPP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 166.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.34 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|