C13H15N9O6S3 — CID 59787573
3-[[4-(2-aminoethylamino)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid (PubChem CID 59787573) has the molecular formula C13H15N9O6S3 and a molecular weight of 489.52 g/mol. Its IUPAC name is 3-[[4-(2-aminoethylamino)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid.
| Compound Name | 3-[[4-(2-aminoethylamino)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 59787573 |
| Molecular Formula | C13H15N9O6S3 |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 3-[[4-(2-aminoethylamino)-6-(1H-1,2,4-triazol-5-ylsulfanyl)-1,3,5-triazin-2-yl]amino]-4-(trioxidanylsulfanyl)benzenesulfonic acid |
| SMILES | NCCNc1nc(Nc2cc(S(=O)(=O)O)ccc2SOOO)nc(Sc2ncn[nH]2)n1 |
| InChI | InChI=1S/C13H15N9O6S3/c14-3-4-15-10-19-11(21-13(20-10)29-12-16-6-17-22-12)18-8-5-7(31(24,25)26)1-2-9(8)30-28-27-23/h1-2,5-6,23H,3-4,14H2,(H,16,17,22)(H,24,25,26)(H2,15,18,19,20,21) |
| InChIKey | KMIXAYIIXNPFIT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 223.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|