C11H21N5O6S4 — CID 59787575
3-[[4-(2-aminoethylamino)-6-(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid (PubChem CID 59787575) has the molecular formula C11H21N5O6S4 and a molecular weight of 447.59 g/mol. Its IUPAC name is 3-[[4-(2-aminoethylamino)-6-(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid.
| Compound Name | 3-[[4-(2-aminoethylamino)-6-(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59787575 |
| Molecular Formula | C11H21N5O6S4 |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 3-[[4-(2-aminoethylamino)-6-(3-sulfopropylsulfanyl)-1,3,5-triazin-2-yl]sulfanyl]propane-1-sulfonic acid |
| SMILES | NCCNc1nc(SCCCS(=O)(=O)O)nc(SCCCS(=O)(=O)O)n1 |
| InChI | InChI=1S/C11H21N5O6S4/c12-3-4-13-9-14-10(23-5-1-7-25(17,18)19)16-11(15-9)24-6-2-8-26(20,21)22/h1-8,12H2,(H,17,18,19)(H,20,21,22)(H,13,14,15,16) |
| InChIKey | ZDASLCNNZIFNKU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 185.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|