C27H20F4O2 — CID 59787675
(3,5-difluoro-4-methylphenyl) 1,3-difluoro-6-(2,4,6-trimethylphenyl)naphthalene-2-carboxylate (PubChem CID 59787675) has the molecular formula C27H20F4O2 and a molecular weight of 452.45 g/mol. Its IUPAC name is (3,5-difluoro-4-methylphenyl) 1,3-difluoro-6-(2,4,6-trimethylphenyl)naphthalene-2-carboxylate.
| Compound Name | (3,5-difluoro-4-methylphenyl) 1,3-difluoro-6-(2,4,6-trimethylphenyl)naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 59787675 |
| Molecular Formula | C27H20F4O2 |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (3,5-difluoro-4-methylphenyl) 1,3-difluoro-6-(2,4,6-trimethylphenyl)naphthalene-2-carboxylate |
| SMILES | Cc1cc(C)c(-c2ccc3c(F)c(C(=O)Oc4cc(F)c(C)c(F)c4)c(F)cc3c2)c(C)c1 |
| InChI | InChI=1S/C27H20F4O2/c1-13-7-14(2)24(15(3)8-13)17-5-6-20-18(9-17)10-23(30)25(26(20)31)27(32)33-19-11-21(28)16(4)22(29)12-19/h5-12H,1-4H3 |
| InChIKey | QQPXEDFBSQAIDP-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|