C27H21F3O2 — CID 59787686
[4-(4,5,7-trifluoro-6-methylnaphthalen-2-yl)phenyl] 2,4,6-trimethylbenzoate (PubChem CID 59787686) has the molecular formula C27H21F3O2 and a molecular weight of 434.46 g/mol. Its IUPAC name is [4-(4,5,7-trifluoro-6-methylnaphthalen-2-yl)phenyl] 2,4,6-trimethylbenzoate.
| Compound Name | [4-(4,5,7-trifluoro-6-methylnaphthalen-2-yl)phenyl] 2,4,6-trimethylbenzoate |
|---|---|
| PubChem CID | 59787686 |
| Molecular Formula | C27H21F3O2 |
| Molecular Weight | 434.46 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | [4-(4,5,7-trifluoro-6-methylnaphthalen-2-yl)phenyl] 2,4,6-trimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)Oc2ccc(-c3cc(F)c4c(F)c(C)c(F)cc4c3)cc2)c(C)c1 |
| InChI | InChI=1S/C27H21F3O2/c1-14-9-15(2)24(16(3)10-14)27(31)32-21-7-5-18(6-8-21)19-11-20-13-22(28)17(4)26(30)25(20)23(29)12-19/h5-13H,1-4H3 |
| InChIKey | UHMBJGHVTVCQBR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.46 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|