About N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide
N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide (PubChem CID 59788597) has the molecular formula C21H15N3O3S
and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide |
| PubChem CID | 59788597 |
| Molecular Formula | C21H15N3O3S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide |
| SMILES | O=C(c1ccccc1NS(=O)(=O)c1ccccc1)c1nccc2ncccc12 |
| InChI | InChI=1S/C21H15N3O3S/c25-21(20-16-10-6-13-22-18(16)12-14-23-20)17-9-4-5-11-19(17)24-28(26,27)15-7-2-1-3-8-15/h1-14,24H |
| InChIKey | AVHGVBRVSSPKAH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide?
The IUPAC name of N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide (CID 59788597) is N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide.
What is the SMILES notation for N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide?
The canonical SMILES for N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide is O=C(c1ccccc1NS(=O)(=O)c1ccccc1)c1nccc2ncccc12.
What is the InChIKey of N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide?
The InChIKey is AVHGVBRVSSPKAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15N3O3S/c25-21(20-16-10-6-13-22-18(16)12-14-23-20)17-9-4-5-11-19(17)24-28(26,27)15-7-2-1-3-8-15/h1-14,24H.
What are the key properties of N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide?
N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide has a molecular weight of 389.44 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,6-naphthyridine-5-carbonyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 59788597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).