About 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide
4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide (PubChem CID 59788711) has the molecular formula C22H20F2N2O3S
and a molecular weight of 430.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide |
| PubChem CID | 59788711 |
| Molecular Formula | C22H20F2N2O3S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2C(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C22H20F2N2O3S/c1-22(2,3)15-6-8-16(9-7-15)30(28,29)26-18-11-10-17(23)20(24)19(18)21(27)14-5-4-12-25-13-14/h4-13,26H,1-3H3 |
| InChIKey | CGNBINVSTGGRLK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide?
The IUPAC name of 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide (CID 59788711) is 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide.
What is the SMILES notation for 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide?
The canonical SMILES for 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide is CC(C)(C)c1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2C(=O)c2cccnc2)cc1.
What is the InChIKey of 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide?
The InChIKey is CGNBINVSTGGRLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20F2N2O3S/c1-22(2,3)15-6-8-16(9-7-15)30(28,29)26-18-11-10-17(23)20(24)19(18)21(27)14-5-4-12-25-13-14/h4-13,26H,1-3H3.
What are the key properties of 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide?
4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide has a molecular weight of 430.48 g/mol, XLogP of 4.69, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-N-[3,4-difluoro-2-(pyridine-3-carbonyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 59788711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).