C26H33FN2O3 — CID 59788827
(E,4R,6S)-8-[4-(4-fluorophenyl)-8-methyl-2-propan-2-yl-6,7-dihydro-5H-1,8-naphthyridin-3-yl]-4,6-dihydroxyoct-7-en-2-one (PubChem CID 59788827) has the molecular formula C26H33FN2O3 and a molecular weight of 440.56 g/mol. Its IUPAC name is (E,4R,6S)-8-[4-(4-fluorophenyl)-8-methyl-2-propan-2-yl-6,7-dihydro-5H-1,8-naphthyridin-3-yl]-4,6-dihydroxyoct-7-en-2-one.
| Compound Name | (E,4R,6S)-8-[4-(4-fluorophenyl)-8-methyl-2-propan-2-yl-6,7-dihydro-5H-1,8-naphthyridin-3-yl]-4,6-dihydroxyoct-7-en-2-one |
|---|---|
| PubChem CID | 59788827 |
| Molecular Formula | C26H33FN2O3 |
| Molecular Weight | 440.56 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | (E,4R,6S)-8-[4-(4-fluorophenyl)-8-methyl-2-propan-2-yl-6,7-dihydro-5H-1,8-naphthyridin-3-yl]-4,6-dihydroxyoct-7-en-2-one |
| SMILES | CC(=O)C[C@H](O)C[C@H](O)/C=C/c1c(C(C)C)nc2c(c1-c1ccc(F)cc1)CCCN2C |
| InChI | InChI=1S/C26H33FN2O3/c1-16(2)25-22(12-11-20(31)15-21(32)14-17(3)30)24(18-7-9-19(27)10-8-18)23-6-5-13-29(4)26(23)28-25/h7-12,16,20-21,31-32H,5-6,13-15H2,1-4H3/b12-11+/t20-,21+/m1/s1 |
| InChIKey | YBZXKWJACNQEBK-KUIZBPSLSA-N |
| XLogP | 4.50 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |