About N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide
N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide (PubChem CID 59788917) has the molecular formula C24H14Cl2F3NO3
and a molecular weight of 492.28 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide |
| PubChem CID | 59788917 |
| Molecular Formula | C24H14Cl2F3NO3 |
| Molecular Weight | 492.28 g/mol |
| Exact Mass | 491.03 |
| IUPAC Name | N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2ccc3c(C(F)(F)F)c(C(=O)c4ccc(Cl)cc4Cl)oc3c2)c1 |
| InChI | InChI=1S/C24H14Cl2F3NO3/c1-12(31)30-16-4-2-3-13(9-16)14-5-7-18-20(10-14)33-23(21(18)24(27,28)29)22(32)17-8-6-15(25)11-19(17)26/h2-11H,1H3,(H,30,31) |
| InChIKey | JJUYIMVPKQEOOV-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.28 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide?
The IUPAC name of N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide (CID 59788917) is N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide?
The canonical SMILES for N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide is CC(=O)Nc1cccc(-c2ccc3c(C(F)(F)F)c(C(=O)c4ccc(Cl)cc4Cl)oc3c2)c1.
What is the InChIKey of N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide?
The InChIKey is JJUYIMVPKQEOOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H14Cl2F3NO3/c1-12(31)30-16-4-2-3-13(9-16)14-5-7-18-20(10-14)33-23(21(18)24(27,28)29)22(32)17-8-6-15(25)11-19(17)26/h2-11H,1H3,(H,30,31).
What are the key properties of N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide?
N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide has a molecular weight of 492.28 g/mol, XLogP of 7.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[2-(2,4-dichlorobenzoyl)-3-(trifluoromethyl)-1-benzofuran-6-yl]phenyl]acetamide is sourced from PubChem (CID 59788917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).