C61H44O4 — CID 59789089
4-[2-[2,4,5-tris[2-(4-acetylphenyl)phenyl]phenyl]phenyl]benzaldehyde (PubChem CID 59789089) has the molecular formula C61H44O4 and a molecular weight of 841.02 g/mol. Its IUPAC name is 4-[2-[2,4,5-tris[2-(4-acetylphenyl)phenyl]phenyl]phenyl]benzaldehyde.
| Compound Name | 4-[2-[2,4,5-tris[2-(4-acetylphenyl)phenyl]phenyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 59789089 |
| Molecular Formula | C61H44O4 |
| Molecular Weight | 841.02 g/mol |
| Exact Mass | 840.32 |
| IUPAC Name | 4-[2-[2,4,5-tris[2-(4-acetylphenyl)phenyl]phenyl]phenyl]benzaldehyde |
| SMILES | CC(=O)c1ccc(-c2ccccc2-c2cc(-c3ccccc3-c3ccc(C(C)=O)cc3)c(-c3ccccc3-c3ccc(C(C)=O)cc3)cc2-c2ccccc2-c2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C61H44O4/c1-39(63)43-24-30-47(31-25-43)51-13-5-9-17-55(51)59-37-61(57-19-11-7-15-53(57)49-34-28-45(29-35-49)41(3)65)60(56-18-10-6-14-52(56)48-32-26-44(27-33-48)40(2)64)36-58(59)54-16-8-4-12-50(54)46-22-20-42(38-62)21-23-46/h4-38H,1-3H3 |
| InChIKey | DQHQESAKJGPPHZ-UHFFFAOYSA-N |
| XLogP | 15.44 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 841.02 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|