C27H27N5O3 — CID 59789664
3-[6-(4-anilino-2-methoxyanilino)-2-morpholin-4-ylpyrimidin-4-yl]phenol (PubChem CID 59789664) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 3-[6-(4-anilino-2-methoxyanilino)-2-morpholin-4-ylpyrimidin-4-yl]phenol.
| Compound Name | 3-[6-(4-anilino-2-methoxyanilino)-2-morpholin-4-ylpyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 59789664 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-[6-(4-anilino-2-methoxyanilino)-2-morpholin-4-ylpyrimidin-4-yl]phenol |
| SMILES | COc1cc(Nc2ccccc2)ccc1Nc1cc(-c2cccc(O)c2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C27H27N5O3/c1-34-25-17-21(28-20-7-3-2-4-8-20)10-11-23(25)29-26-18-24(19-6-5-9-22(33)16-19)30-27(31-26)32-12-14-35-15-13-32/h2-11,16-18,28,33H,12-15H2,1H3,(H,29,30,31) |
| InChIKey | FFIGUQVTXCBLOH-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |