C22H28N2O3 — CID 597899
methyl 2-(8-acetyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-12-yl)acetate (PubChem CID 597899) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is methyl 2-(8-acetyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-12-yl)acetate.
| Compound Name | methyl 2-(8-acetyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-12-yl)acetate |
|---|---|
| PubChem CID | 597899 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | methyl 2-(8-acetyl-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6-trien-12-yl)acetate |
| SMILES | COC(=O)CC12CCCN3CCC4(c5ccccc5N(C(C)=O)C4CC1)C32 |
| InChI | InChI=1S/C22H28N2O3/c1-15(25)24-17-7-4-3-6-16(17)22-11-13-23-12-5-9-21(20(22)23,10-8-18(22)24)14-19(26)27-2/h3-4,6-7,18,20H,5,8-14H2,1-2H3 |
| InChIKey | CGBORLREKLCHSI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |