C19H19N2OS+ — CID 59790479
4-(3,4-dihydro-[1,4]oxazino[3,4-b][1,3]benzothiazol-5-ium-1-ylidenemethyl)-N,N-dimethylaniline (PubChem CID 59790479) has the molecular formula C19H19N2OS+ and a molecular weight of 323.44 g/mol. Its IUPAC name is 4-(3,4-dihydro-[1,4]oxazino[3,4-b][1,3]benzothiazol-5-ium-1-ylidenemethyl)-N,N-dimethylaniline.
| Compound Name | 4-(3,4-dihydro-[1,4]oxazino[3,4-b][1,3]benzothiazol-5-ium-1-ylidenemethyl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 59790479 |
| Molecular Formula | C19H19N2OS+ |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 4-(3,4-dihydro-[1,4]oxazino[3,4-b][1,3]benzothiazol-5-ium-1-ylidenemethyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=C2OCC[n+]3c2sc2ccccc23)cc1 |
| InChI | InChI=1S/C19H19N2OS/c1-20(2)15-9-7-14(8-10-15)13-17-19-21(11-12-22-17)16-5-3-4-6-18(16)23-19/h3-10,13H,11-12H2,1-2H3/q+1 |
| InChIKey | DYCMGTZELCBYBW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|