C21H15Cl2N2S2+ — CID 59790480
7-chloro-3-[(7-chloro-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazol-9-ium-3-ylidene)methyl]-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazole (PubChem CID 59790480) has the molecular formula C21H15Cl2N2S2+ and a molecular weight of 430.41 g/mol. Its IUPAC name is 7-chloro-3-[(7-chloro-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazol-9-ium-3-ylidene)methyl]-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazole.
| Compound Name | 7-chloro-3-[(7-chloro-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazol-9-ium-3-ylidene)methyl]-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazole |
|---|---|
| PubChem CID | 59790480 |
| Molecular Formula | C21H15Cl2N2S2+ |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 429.00 |
| IUPAC Name | 7-chloro-3-[(7-chloro-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazol-9-ium-3-ylidene)methyl]-1,2-dihydropyrrolo[2,1-b][1,3]benzothiazole |
| SMILES | Clc1ccc2c(c1)N1CCC(C=C3CC[n+]4c3sc3ccc(Cl)cc34)=C1S2 |
| InChI | InChI=1S/C21H15Cl2N2S2/c22-14-1-3-18-16(10-14)24-7-5-12(20(24)26-18)9-13-6-8-25-17-11-15(23)2-4-19(17)27-21(13)25/h1-4,9-11H,5-8H2/q+1 |
| InChIKey | PVTQMJKOSPBHQR-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|