C26H32N2O5 — CID 59790910
(3-cyano-2-isocyano-4-methylphenyl) 4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]cyclohexane-1-carboxylate (PubChem CID 59790910) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is (3-cyano-2-isocyano-4-methylphenyl) 4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]cyclohexane-1-carboxylate.
| Compound Name | (3-cyano-2-isocyano-4-methylphenyl) 4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 59790910 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (3-cyano-2-isocyano-4-methylphenyl) 4-[4-(oxiran-2-ylmethoxymethoxy)cyclohexyl]cyclohexane-1-carboxylate |
| SMILES | [C-]#[N+]c1c(OC(=O)C2CCC(C3CCC(OCOCC4CO4)CC3)CC2)ccc(C)c1C#N |
| InChI | InChI=1S/C26H32N2O5/c1-17-3-12-24(25(28-2)23(17)13-27)33-26(29)20-6-4-18(5-7-20)19-8-10-21(11-9-19)32-16-30-14-22-15-31-22/h3,12,18-22H,4-11,14-16H2,1H3 |
| InChIKey | YRKNLRVGLGXPBV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 85.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|