C30H54O7 — CID 59791295
methyl 3-ethyl-2-[2-[2-(2-ethylhexoxy)-2-oxoethyl]-2-heptan-3-yl-5-oxo-1,3-dioxolan-4-yl]heptanoate (PubChem CID 59791295) has the molecular formula C30H54O7 and a molecular weight of 526.76 g/mol. Its IUPAC name is methyl 3-ethyl-2-[2-[2-(2-ethylhexoxy)-2-oxoethyl]-2-heptan-3-yl-5-oxo-1,3-dioxolan-4-yl]heptanoate.
| Compound Name | methyl 3-ethyl-2-[2-[2-(2-ethylhexoxy)-2-oxoethyl]-2-heptan-3-yl-5-oxo-1,3-dioxolan-4-yl]heptanoate |
|---|---|
| PubChem CID | 59791295 |
| Molecular Formula | C30H54O7 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.39 |
| IUPAC Name | methyl 3-ethyl-2-[2-[2-(2-ethylhexoxy)-2-oxoethyl]-2-heptan-3-yl-5-oxo-1,3-dioxolan-4-yl]heptanoate |
| SMILES | CCCCC(CC)COC(=O)CC1(C(CC)CCCC)OC(=O)C(C(C(=O)OC)C(CC)CCCC)O1 |
| InChI | InChI=1S/C30H54O7/c1-8-14-17-22(11-4)21-35-25(31)20-30(24(13-6)19-16-10-3)36-27(29(33)37-30)26(28(32)34-7)23(12-5)18-15-9-2/h22-24,26-27H,8-21H2,1-7H3 |
| InChIKey | BTUVUQMCHQLZHO-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|