About 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol
3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol (PubChem CID 59791651) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol.
Analyze 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol?
The IUPAC name of 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol (CID 59791651) is 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol.
What is the SMILES notation for 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol?
The canonical SMILES for 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol is OC1COC2CCNC12.
What is the InChIKey of 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol?
The InChIKey is CDMLEMBRAYSSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c8-4-3-9-5-1-2-7-6(4)5/h4-8H,1-3H2.
What are the key properties of 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol?
3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol has a molecular weight of 129.16 g/mol, XLogP of -0.89, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a,4,5,6,6a-hexahydro-2H-furo[3,2-b]pyrrol-3-ol is sourced from PubChem (CID 59791651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).