About 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one
1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one (PubChem CID 59791736) has the molecular formula C6H9N2OS-
and a molecular weight of 157.22 g/mol. Its IUPAC name is 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one.
Molecular Properties
| Compound Name | 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one |
| PubChem CID | 59791736 |
| Molecular Formula | C6H9N2OS- |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.04 |
| IUPAC Name | 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one |
| SMILES | CN1[N-]CC2SCC(=O)C21 |
| InChI | InChI=1S/C6H9N2OS/c1-8-6-4(9)3-10-5(6)2-7-8/h5-6H,2-3H2,1H3/q-1 |
| InChIKey | OVBBQMOXJGSMAR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one?
The IUPAC name of 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one (CID 59791736) is 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one.
What is the SMILES notation for 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one?
The canonical SMILES for 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one is CN1[N-]CC2SCC(=O)C21.
What is the InChIKey of 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one?
The InChIKey is OVBBQMOXJGSMAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N2OS/c1-8-6-4(9)3-10-5(6)2-7-8/h5-6H,2-3H2,1H3/q-1.
What are the key properties of 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one?
1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one has a molecular weight of 157.22 g/mol, XLogP of 0.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3a,6a-dihydro-3H-thieno[3,2-c]pyrazol-2-id-6-one is sourced from PubChem (CID 59791736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).