About (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol
(1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol (PubChem CID 59792382) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol.
Molecular Properties
| Compound Name | (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol |
| PubChem CID | 59792382 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol |
| SMILES | OCC12COC(C3CCC3)(OC1)OC2 |
| InChI | InChI=1S/C10H16O4/c11-4-9-5-12-10(13-6-9,14-7-9)8-2-1-3-8/h8,11H,1-7H2 |
| InChIKey | USJVWAGYMFDQOA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol?
The IUPAC name of (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol (CID 59792382) is (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol.
What is the SMILES notation for (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol?
The canonical SMILES for (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol is OCC12COC(C3CCC3)(OC1)OC2.
What is the InChIKey of (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol?
The InChIKey is USJVWAGYMFDQOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c11-4-9-5-12-10(13-6-9,14-7-9)8-2-1-3-8/h8,11H,1-7H2.
What are the key properties of (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol?
(1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol has a molecular weight of 200.23 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyclobutyl-2,6,7-trioxabicyclo[2.2.2]octan-4-yl)methanol is sourced from PubChem (CID 59792382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).