C17H25NO6 — CID 59792506
4-[2-(8-ethyl-1,4,7,9-tetraoxaspiro[4.5]decan-8-yl)ethoxy]-2,3-dimethyl-1-oxidopyridin-1-ium (PubChem CID 59792506) has the molecular formula C17H25NO6 and a molecular weight of 339.39 g/mol. Its IUPAC name is 4-[2-(8-ethyl-1,4,7,9-tetraoxaspiro[4.5]decan-8-yl)ethoxy]-2,3-dimethyl-1-oxidopyridin-1-ium.
| Compound Name | 4-[2-(8-ethyl-1,4,7,9-tetraoxaspiro[4.5]decan-8-yl)ethoxy]-2,3-dimethyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 59792506 |
| Molecular Formula | C17H25NO6 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 4-[2-(8-ethyl-1,4,7,9-tetraoxaspiro[4.5]decan-8-yl)ethoxy]-2,3-dimethyl-1-oxidopyridin-1-ium |
| SMILES | CCC1(CCOc2cc[n+]([O-])c(C)c2C)OCC2(CO1)OCCO2 |
| InChI | InChI=1S/C17H25NO6/c1-4-16(23-11-17(12-24-16)21-9-10-22-17)6-8-20-15-5-7-18(19)14(3)13(15)2/h5,7H,4,6,8-12H2,1-3H3 |
| InChIKey | SGLCGDKKEVNSCC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 73.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|