About 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate
3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate (PubChem CID 59793356) has the molecular formula C27H45NO8
and a molecular weight of 511.66 g/mol. Its IUPAC name is 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate.
Molecular Properties
| Compound Name | 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate |
| PubChem CID | 59793356 |
| Molecular Formula | C27H45NO8 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate |
| SMILES | CCCC(=O)OCCCOCCCOCCCOC(=O)CCN(C)CCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C27H45NO8/c1-5-9-26(29)35-20-7-18-33-16-6-17-34-19-8-21-36-27(30)13-15-28(2)14-12-23-10-11-24(31-3)25(22-23)32-4/h10-11,22H,5-9,12-21H2,1-4H3 |
| InChIKey | VQZPVSGUABTVHY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate?
The IUPAC name of 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate (CID 59793356) is 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate.
What is the SMILES notation for 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate?
The canonical SMILES for 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate is CCCC(=O)OCCCOCCCOCCCOC(=O)CCN(C)CCc1ccc(OC)c(OC)c1.
What is the InChIKey of 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate?
The InChIKey is VQZPVSGUABTVHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H45NO8/c1-5-9-26(29)35-20-7-18-33-16-6-17-34-19-8-21-36-27(30)13-15-28(2)14-12-23-10-11-24(31-3)25(22-23)32-4/h10-11,22H,5-9,12-21H2,1-4H3.
What are the key properties of 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate?
3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate has a molecular weight of 511.66 g/mol, XLogP of 3.66, 22 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[3-[3-[2-(3,4-dimethoxyphenyl)ethyl-methylamino]propanoyloxy]propoxy]propoxy]propyl butanoate is sourced from PubChem (CID 59793356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).