C16H20N2S — CID 59793419
1,5,7,14,14-pentamethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene (PubChem CID 59793419) has the molecular formula C16H20N2S and a molecular weight of 272.42 g/mol. Its IUPAC name is 1,5,7,14,14-pentamethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene.
| Compound Name | 1,5,7,14,14-pentamethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene |
|---|---|
| PubChem CID | 59793419 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1,5,7,14,14-pentamethyl-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene |
| SMILES | Cc1sc(C)c2nc3c(nc12)C1CCC3(C)C1(C)C |
| InChI | InChI=1S/C16H20N2S/c1-8-11-12(9(2)19-8)18-14-13(17-11)10-6-7-16(14,5)15(10,3)4/h10H,6-7H2,1-5H3 |
| InChIKey | DUCNINLRGLPBQX-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |