C44H37N3S — CID 59793424
N,N-diphenyl-4-[1,14,14-trimethyl-7-(4-phenylphenyl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl]aniline (PubChem CID 59793424) has the molecular formula C44H37N3S and a molecular weight of 639.87 g/mol. Its IUPAC name is N,N-diphenyl-4-[1,14,14-trimethyl-7-(4-phenylphenyl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl]aniline.
| Compound Name | N,N-diphenyl-4-[1,14,14-trimethyl-7-(4-phenylphenyl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl]aniline |
|---|---|
| PubChem CID | 59793424 |
| Molecular Formula | C44H37N3S |
| Molecular Weight | 639.87 g/mol |
| Exact Mass | 639.27 |
| IUPAC Name | N,N-diphenyl-4-[1,14,14-trimethyl-7-(4-phenylphenyl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraen-5-yl]aniline |
| SMILES | CC12CCC(c3nc4c(-c5ccc(-c6ccccc6)cc5)sc(-c5ccc(N(c6ccccc6)c6ccccc6)cc5)c4nc31)C2(C)C |
| InChI | InChI=1S/C44H37N3S/c1-43(2)36-27-28-44(43,3)42-37(36)45-38-39(46-42)41(48-40(38)31-21-19-30(20-22-31)29-13-7-4-8-14-29)32-23-25-35(26-24-32)47(33-15-9-5-10-16-33)34-17-11-6-12-18-34/h4-26,36H,27-28H2,1-3H3 |
| InChIKey | KAWQMPXZJDMVMY-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.87 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |