C42H34N4S — CID 59793432
1,14,14-trimethyl-5,7-bis(1-phenylindol-5-yl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene (PubChem CID 59793432) has the molecular formula C42H34N4S and a molecular weight of 626.83 g/mol. Its IUPAC name is 1,14,14-trimethyl-5,7-bis(1-phenylindol-5-yl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene.
| Compound Name | 1,14,14-trimethyl-5,7-bis(1-phenylindol-5-yl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene |
|---|---|
| PubChem CID | 59793432 |
| Molecular Formula | C42H34N4S |
| Molecular Weight | 626.83 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | 1,14,14-trimethyl-5,7-bis(1-phenylindol-5-yl)-6-thia-3,9-diazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,4,7,9-tetraene |
| SMILES | CC12CCC(c3nc4c(-c5ccc6c(ccn6-c6ccccc6)c5)sc(-c5ccc6c(ccn6-c6ccccc6)c5)c4nc31)C2(C)C |
| InChI | InChI=1S/C42H34N4S/c1-41(2)32-18-21-42(41,3)40-35(32)43-36-37(44-40)39(29-15-17-34-27(25-29)20-23-46(34)31-12-8-5-9-13-31)47-38(36)28-14-16-33-26(24-28)19-22-45(33)30-10-6-4-7-11-30/h4-17,19-20,22-25,32H,18,21H2,1-3H3 |
| InChIKey | FXBCOXAWDKMOQA-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.83 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |