About 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+)
9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) (PubChem CID 59793757) has the molecular formula C8H13N2ORb
and a molecular weight of 238.67 g/mol. Its IUPAC name is 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+).
Molecular Properties
| Compound Name | 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) |
| PubChem CID | 59793757 |
| Molecular Formula | C8H13N2ORb |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) |
| SMILES | CN1C2C[N-]CC1CC(=O)C2.[Rb+] |
| InChI | InChI=1S/C8H13N2O.Rb/c1-10-6-2-8(11)3-7(10)5-9-4-6;/h6-7H,2-5H2,1H3;/q-1;+1 |
| InChIKey | PZZRZEMKEKLLKR-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 34.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+)?
The IUPAC name of 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) (CID 59793757) is 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+).
What is the SMILES notation for 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+)?
The canonical SMILES for 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) is CN1C2C[N-]CC1CC(=O)C2.[Rb+].
What is the InChIKey of 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+)?
The InChIKey is PZZRZEMKEKLLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2O.Rb/c1-10-6-2-8(11)3-7(10)5-9-4-6;/h6-7H,2-5H2,1H3;/q-1;+1.
What are the key properties of 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+)?
9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) has a molecular weight of 238.67 g/mol, XLogP of -2.59, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-9-aza-3-azanidabicyclo[3.3.1]nonan-7-one;rubidium(1+) is sourced from PubChem (CID 59793757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).