About 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one
9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one (PubChem CID 59793758) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
Molecular Properties
| Compound Name | 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| PubChem CID | 59793758 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one |
| SMILES | CN1C2CNCC1CC(=O)C2 |
| InChI | InChI=1S/C8H14N2O/c1-10-6-2-8(11)3-7(10)5-9-4-6/h6-7,9H,2-5H2,1H3 |
| InChIKey | GUYSXXWKBRWNQJ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The IUPAC name of 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one (CID 59793758) is 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one.
What is the SMILES notation for 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The canonical SMILES for 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one is CN1C2CNCC1CC(=O)C2.
What is the InChIKey of 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
The InChIKey is GUYSXXWKBRWNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-10-6-2-8(11)3-7(10)5-9-4-6/h6-7,9H,2-5H2,1H3.
What are the key properties of 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one?
9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one has a molecular weight of 154.21 g/mol, XLogP of -0.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-3,9-diazabicyclo[3.3.1]nonan-7-one is sourced from PubChem (CID 59793758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).