C31H44N2O3Si — CID 59793761
benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate (PubChem CID 59793761) has the molecular formula C31H44N2O3Si and a molecular weight of 520.79 g/mol. Its IUPAC name is benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate.
| Compound Name | benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate |
|---|---|
| PubChem CID | 59793761 |
| Molecular Formula | C31H44N2O3Si |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | benzyl 7-[4-[3-[tert-butyl(dimethyl)silyl]oxypropyl]phenyl]-9-methyl-3,9-diazabicyclo[3.3.1]non-6-ene-6-carboxylate |
| SMILES | CN1C2CNCC1C(C(=O)OCc1ccccc1)=C(c1ccc(CCCO[Si](C)(C)C(C)(C)C)cc1)C2 |
| InChI | InChI=1S/C31H44N2O3Si/c1-31(2,3)37(5,6)36-18-10-13-23-14-16-25(17-15-23)27-19-26-20-32-21-28(33(26)4)29(27)30(34)35-22-24-11-8-7-9-12-24/h7-9,11-12,14-17,26,28,32H,10,13,18-22H2,1-6H3 |
| InChIKey | LOHHUTSYORLKAT-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|