C20H18ClFN4O2 — CID 59794037
2-[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one (PubChem CID 59794037) has the molecular formula C20H18ClFN4O2 and a molecular weight of 400.84 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one.
| Compound Name | 2-[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 59794037 |
| Molecular Formula | C20H18ClFN4O2 |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenyl)morpholin-4-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(N2CCOC(c3ccc(F)cc3Cl)C2)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C20H18ClFN4O2/c1-25-19(27)11-17(13-4-6-23-7-5-13)24-20(25)26-8-9-28-18(12-26)15-3-2-14(22)10-16(15)21/h2-7,10-11,18H,8-9,12H2,1H3 |
| InChIKey | YRRLUPVLHWGESV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |