C24H22N4O2S — CID 59794086
2-[3-(1-benzothiophene-2-carbonyl)piperidin-1-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one (PubChem CID 59794086) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is 2-[3-(1-benzothiophene-2-carbonyl)piperidin-1-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one.
| Compound Name | 2-[3-(1-benzothiophene-2-carbonyl)piperidin-1-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
|---|---|
| PubChem CID | 59794086 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 2-[3-(1-benzothiophene-2-carbonyl)piperidin-1-yl]-3-methyl-6-pyridin-4-ylpyrimidin-4-one |
| SMILES | Cn1c(N2CCCC(C(=O)c3cc4ccccc4s3)C2)nc(-c2ccncc2)cc1=O |
| InChI | InChI=1S/C24H22N4O2S/c1-27-22(29)14-19(16-8-10-25-11-9-16)26-24(27)28-12-4-6-18(15-28)23(30)21-13-17-5-2-3-7-20(17)31-21/h2-3,5,7-11,13-14,18H,4,6,12,15H2,1H3 |
| InChIKey | JMVLMVCPWAZDDB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |