About 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene
8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene (PubChem CID 59795057) has the molecular formula C12H14F2O
and a molecular weight of 212.24 g/mol. Its IUPAC name is 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene |
| PubChem CID | 59795057 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene |
| SMILES | Cc1cc2c(c(C(F)F)c1)OC(C)CC2 |
| InChI | InChI=1S/C12H14F2O/c1-7-5-9-4-3-8(2)15-11(9)10(6-7)12(13)14/h5-6,8,12H,3-4H2,1-2H3 |
| InChIKey | MWRYBVNLZNWHLT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene?
The IUPAC name of 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene (CID 59795057) is 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene.
What is the SMILES notation for 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene?
The canonical SMILES for 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene is Cc1cc2c(c(C(F)F)c1)OC(C)CC2.
What is the InChIKey of 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene?
The InChIKey is MWRYBVNLZNWHLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O/c1-7-5-9-4-3-8(2)15-11(9)10(6-7)12(13)14/h5-6,8,12H,3-4H2,1-2H3.
What are the key properties of 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene?
8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene has a molecular weight of 212.24 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(difluoromethyl)-2,6-dimethyl-3,4-dihydro-2H-chromene is sourced from PubChem (CID 59795057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).