About 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene
2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene (PubChem CID 59795105) has the molecular formula C19H26F2O
and a molecular weight of 308.41 g/mol. Its IUPAC name is 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene.
Molecular Properties
| Compound Name | 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene |
| PubChem CID | 59795105 |
| Molecular Formula | C19H26F2O |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene |
| SMILES | Fc1ccc2c(c1F)OC(CCCCC1CCCCC1)CC2 |
| InChI | InChI=1S/C19H26F2O/c20-17-13-11-15-10-12-16(22-19(15)18(17)21)9-5-4-8-14-6-2-1-3-7-14/h11,13-14,16H,1-10,12H2 |
| InChIKey | IWOSWZNXMICSDR-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene?
The IUPAC name of 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene (CID 59795105) is 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene.
What is the SMILES notation for 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene?
The canonical SMILES for 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene is Fc1ccc2c(c1F)OC(CCCCC1CCCCC1)CC2.
What is the InChIKey of 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene?
The InChIKey is IWOSWZNXMICSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26F2O/c20-17-13-11-15-10-12-16(22-19(15)18(17)21)9-5-4-8-14-6-2-1-3-7-14/h11,13-14,16H,1-10,12H2.
What are the key properties of 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene?
2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene has a molecular weight of 308.41 g/mol, XLogP of 5.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyclohexylbutyl)-7,8-difluoro-3,4-dihydro-2H-chromene is sourced from PubChem (CID 59795105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).